C17H23N6O14P3 — CID 137203008
[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [[(4-aminophenoxy)-hydroxyphosphoryl]oxy-hydroxyphosphoryl] phosphate (PubChem CID 137203008) has the molecular formula C17H23N6O14P3 and a molecular weight of 628.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [[(4-aminophenoxy)-hydroxyphosphoryl]oxy-hydroxyphosphoryl] phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [[(4-aminophenoxy)-hydroxyphosphoryl]oxy-hydroxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 137203008 |
| Molecular Formula | C17H23N6O14P3 |
| Molecular Weight | 628.32 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [[(4-aminophenoxy)-hydroxyphosphoryl]oxy-hydroxyphosphoryl] phosphate |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(=O)([O-])OP(=O)(O)OP(=O)(O)Oc3ccc(N)cc3)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H23N6O14P3/c1-22-7-23(14-11(22)15(26)21-17(19)20-14)16-13(25)12(24)10(34-16)6-33-38(27,28)36-40(31,32)37-39(29,30)35-9-4-2-8(18)3-5-9/h2-5,7,10,12-13,16,24-25H,6,18H2,1H3,(H5-,19,20,21,26,27,28,29,30,31,32)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | HWRUAHCBAGFMJZ-XNIJJKJLSA-N |
| XLogP | -1.87 |
| TPSA | 307.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.32 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|