C14H19N7O5 — CID 158457666
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one;imidazol-3-ide (PubChem CID 158457666) has the molecular formula C14H19N7O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one;imidazol-3-ide.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one;imidazol-3-ide |
|---|---|
| PubChem CID | 158457666 |
| Molecular Formula | C14H19N7O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one;imidazol-3-ide |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21.c1c[n-]cn1 |
| InChI | InChI=1S/C11H15N5O5.C3H3N2/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10;1-2-5-3-4-1/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20);1-3H/q;-1/p+1/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | HETSHOUSYUCGPQ-MCDZGGTQSA-O |
| XLogP | -3.22 |
| TPSA | 177.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|