C13H20N5O6+ — CID 135590523
2-amino-9-[(3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(1-hydroxypropan-2-yl)-1H-purin-9-ium-6-one (PubChem CID 135590523) has the molecular formula C13H20N5O6+ and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-amino-9-[(3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(1-hydroxypropan-2-yl)-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(1-hydroxypropan-2-yl)-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 135590523 |
| Molecular Formula | C13H20N5O6+ |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-amino-9-[(3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(1-hydroxypropan-2-yl)-1H-purin-9-ium-6-one |
| SMILES | CC(CO)n1c[n+](C2O[C@@H](CO)[C@H](O)[C@@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C13H19N5O6/c1-5(2-19)17-4-18(10-7(17)11(23)16-13(14)15-10)12-9(22)8(21)6(3-20)24-12/h4-6,8-9,12,19-22H,2-3H2,1H3,(H2-,14,15,16,23)/p+1/t5?,6-,8-,9-,12?/m0/s1 |
| InChIKey | PLEPQLPCEOZHHW-OEBHZCHHSA-O |
| XLogP | -3.24 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|