C19H24N5O6+ — CID 136693592
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(1R)-2-hydroxy-1-(4-methylphenyl)ethyl]-1H-purin-9-ium-6-one (PubChem CID 136693592) has the molecular formula C19H24N5O6+ and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(1R)-2-hydroxy-1-(4-methylphenyl)ethyl]-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(1R)-2-hydroxy-1-(4-methylphenyl)ethyl]-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 136693592 |
| Molecular Formula | C19H24N5O6+ |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(1R)-2-hydroxy-1-(4-methylphenyl)ethyl]-1H-purin-9-ium-6-one |
| SMILES | Cc1ccc([C@H](CO)n2c[n+]([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c3nc(N)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C19H23N5O6/c1-9-2-4-10(5-3-9)11(6-25)23-8-24(16-13(23)17(29)22-19(20)21-16)18-15(28)14(27)12(7-26)30-18/h2-5,8,11-12,14-15,18,25-28H,6-7H2,1H3,(H2-,20,21,22,29)/p+1/t11-,12+,14+,15+,18+/m0/s1 |
| InChIKey | IJSJANHYJFTEOR-URQYDQELSA-O |
| XLogP | -1.90 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|