C11H16ClN5O4S — CID 139026133
2-amino-9-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-3H-purin-9-ium-6-thione chloride (PubChem CID 139026133) has the molecular formula C11H16ClN5O4S and a molecular weight of 349.80 g/mol. Its IUPAC name is 2-amino-9-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-3H-purin-9-ium-6-thione chloride.
| Compound Name | 2-amino-9-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-3H-purin-9-ium-6-thione chloride |
|---|---|
| PubChem CID | 139026133 |
| Molecular Formula | C11H16ClN5O4S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-amino-9-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-3H-purin-9-ium-6-thione chloride |
| SMILES | Cn1c[n+]([C@@H]2O[C@@H](CO)C(O)C2O)c2[nH]c(N)nc(=S)c21.[Cl-] |
| InChI | InChI=1S/C11H15N5O4S.ClH/c1-15-3-16(8-5(15)9(21)14-11(12)13-8)10-7(19)6(18)4(2-17)20-10;/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,21);1H/t4-,6?,7?,10+;/m0./s1 |
| InChIKey | BOARWLNQGDFRKL-ZMABLLCBSA-N |
| XLogP | -4.88 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|