C11H16N5O4+ — CID 135516628
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 135516628) has the molecular formula C11H16N5O4+ and a molecular weight of 282.28 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 135516628 |
| Molecular Formula | C11H16N5O4+ |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | Cn1c[n+]([C@H]2C[C@H](O)[C@@H](CO)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H15N5O4/c1-15-4-16(7-2-5(18)6(3-17)20-7)9-8(15)10(19)14-11(12)13-9/h4-7,17-18H,2-3H2,1H3,(H2-,12,13,14,19)/p+1/t5-,6+,7+/m0/s1 |
| InChIKey | OMQUVUUQUJTKDH-RRKCRQDMSA-O |
| XLogP | -2.23 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|