C12H19N6O6P — CID 172744388
[(2S,6R)-6-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-methylmorpholin-2-yl]methyl hydrogen phosphate (PubChem CID 172744388) has the molecular formula C12H19N6O6P and a molecular weight of 374.29 g/mol. Its IUPAC name is [(2S,6R)-6-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-methylmorpholin-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2S,6R)-6-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-methylmorpholin-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 172744388 |
| Molecular Formula | C12H19N6O6P |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(2S,6R)-6-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-methylmorpholin-2-yl]methyl hydrogen phosphate |
| SMILES | CN1C[C@@H](COP(=O)([O-])O)O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)C1 |
| InChI | InChI=1S/C12H19N6O6P/c1-16-3-7(5-23-25(20,21)22)24-8(4-16)18-6-17(2)9-10(18)14-12(13)15-11(9)19/h6-8H,3-5H2,1-2H3,(H4-,13,14,15,19,20,21,22)/t7-,8+/m0/s1 |
| InChIKey | JNGQNSQIOPVFPX-JGVFFNPUSA-N |
| XLogP | -2.56 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|