C13H19N5O10P2 — CID 170196635
[[(3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-ethenyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 170196635) has the molecular formula C13H19N5O10P2 and a molecular weight of 467.27 g/mol. Its IUPAC name is [[(3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-ethenyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[(3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-ethenyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 170196635 |
| Molecular Formula | C13H19N5O10P2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [[(3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-ethenyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | C=C[C@@H]1C(COP(=O)(O)OP(=O)([O-])O)O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@@H]1O |
| InChI | InChI=1S/C13H19N5O10P2/c1-3-6-7(4-26-30(24,25)28-29(21,22)23)27-12(9(6)19)18-5-17(2)8-10(18)15-13(14)16-11(8)20/h3,5-7,9,12,19H,1,4H2,2H3,(H5-,14,15,16,20,21,22,23,24,25)/t6-,7?,9-,12-/m1/s1 |
| InChIKey | LVWZNGSMOIFQLU-PRSYYYMHSA-N |
| XLogP | -2.21 |
| TPSA | 226.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|