C13H23N6O10P2+ — CID 170314928
[(2S,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-(methylaminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 170314928) has the molecular formula C13H23N6O10P2+ and a molecular weight of 485.31 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-(methylaminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-(methylaminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170314928 |
| Molecular Formula | C13H23N6O10P2+ |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-(methylaminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CNC[C@H]1[C@@H](O)[C@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H22N6O10P2/c1-15-3-6-7(4-27-31(25,26)29-30(22,23)24)28-12(9(6)20)19-5-18(2)8-10(19)16-13(14)17-11(8)21/h5-7,9,12,15,20H,3-4H2,1-2H3,(H5-,14,16,17,21,22,23,24,25,26)/p+1/t6-,7-,9-,12-/m1/s1 |
| InChIKey | JEPMMMVBHFIAJF-GRIPGOBMSA-O |
| XLogP | -2.55 |
| TPSA | 235.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|