C12H19BN5O10P2+ — CID 136505360
CID 136505360 (PubChem CID 136505360) has the molecular formula C12H19BN5O10P2+ and a molecular weight of 466.07 g/mol.
| Compound Name | CID 136505360 |
|---|---|
| PubChem CID | 136505360 |
| Molecular Formula | C12H19BN5O10P2+ |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | — |
| SMILES | [B]P(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@@H](OC)C1O |
| InChI | InChI=1S/C12H18BN5O10P2/c1-17-4-18(9-6(17)10(20)16-12(14)15-9)11-8(25-2)7(19)5(27-11)3-26-30(23,24)28-29(13,21)22/h4-5,7-8,11,19H,3H2,1-2H3,(H4-,14,15,16,20,21,22,23,24)/p+1/t5-,7?,8+,11-/m1/s1 |
| InChIKey | UPHUUCQLVWPLRC-DWVWSIQXSA-O |
| XLogP | -2.19 |
| TPSA | 212.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|