C15H22N7O10P2+ — CID 172878659
[[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid (PubChem CID 172878659) has the molecular formula C15H22N7O10P2+ and a molecular weight of 522.33 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 172878659 |
| Molecular Formula | C15H22N7O10P2+ |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
| SMILES | CO[C@H]1[C@@H](O)[C@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)OP(=O)(O)n1ccnc1 |
| InChI | InChI=1S/C15H21N7O10P2/c1-20-7-22(12-9(20)13(24)19-15(16)18-12)14-10(23)11(29-2)8(31-14)5-30-34(27,28)32-33(25,26)21-4-3-17-6-21/h3-4,6-8,10-11,14,23H,5H2,1-2H3,(H4-,16,18,19,24,25,26,27,28)/p+1/t8-,10-,11-,14-/m1/s1 |
| InChIKey | UYMNWTSOELIWLF-IDTAVKCVSA-O |
| XLogP | -1.62 |
| TPSA | 230.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|