C14H20N7NaO10P2+2 — CID 175918762
sodium [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid (PubChem CID 175918762) has the molecular formula C14H20N7NaO10P2+2 and a molecular weight of 531.29 g/mol. Its IUPAC name is sodium [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid.
| Compound Name | sodium [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 175918762 |
| Molecular Formula | C14H20N7NaO10P2+2 |
| Molecular Weight | 531.29 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | sodium [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-imidazol-1-ylphosphinic acid |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)n3ccnc3)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21.[Na+] |
| InChI | InChI=1S/C14H19N7O10P2.Na/c1-19-6-21(11-8(19)12(24)18-14(15)17-11)13-10(23)9(22)7(30-13)4-29-33(27,28)31-32(25,26)20-3-2-16-5-20;/h2-3,5-7,9-10,13,22-23H,4H2,1H3,(H4-,15,17,18,24,25,26,27,28);/q;+1/p+1/t7-,9-,10-,13-;/m1./s1 |
| InChIKey | QZTXQDIYQMOFGU-AZUPYXJKSA-O |
| XLogP | -5.27 |
| TPSA | 241.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.29 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|