C14H19N7O7P+ — CID 136610464
[(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid (PubChem CID 136610464) has the molecular formula C14H19N7O7P+ and a molecular weight of 428.32 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid.
| Compound Name | [(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 136610464 |
| Molecular Formula | C14H19N7O7P+ |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(=O)(O)n3ccnc3)C(O)[C@@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H18N7O7P/c1-19-6-21(11-8(19)12(24)18-14(15)17-11)13-10(23)9(22)7(28-13)4-27-29(25,26)20-3-2-16-5-20/h2-3,5-7,9-10,13,22-23H,4H2,1H3,(H3-,15,17,18,24,25,26)/p+1/t7-,9?,10+,13-/m1/s1 |
| InChIKey | BEELYQXEIFUOLB-CXOKJZQJSA-O |
| XLogP | -2.39 |
| TPSA | 194.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|