C13H20N5O4+ — CID 170293851
2-amino-9-[(3R,4S,5R)-3-hydroxy-4-(methoxymethyl)-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 170293851) has the molecular formula C13H20N5O4+ and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-amino-9-[(3R,4S,5R)-3-hydroxy-4-(methoxymethyl)-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(3R,4S,5R)-3-hydroxy-4-(methoxymethyl)-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 170293851 |
| Molecular Formula | C13H20N5O4+ |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-amino-9-[(3R,4S,5R)-3-hydroxy-4-(methoxymethyl)-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | COC[C@@H]1[C@@H](C)OC([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@@H]1O |
| InChI | InChI=1S/C13H19N5O4/c1-6-7(4-21-3)9(19)12(22-6)18-5-17(2)8-10(18)15-13(14)16-11(8)20/h5-7,9,12,19H,4H2,1-3H3,(H2-,14,15,16,20)/p+1/t6-,7-,9-,12?/m1/s1 |
| InChIKey | HEILZPUUHXFCMT-XWTKCKDOSA-O |
| XLogP | -1.33 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|