C16H25N6O5+ — CID 170194901
2-[(2R,4R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 170194901) has the molecular formula C16H25N6O5+ and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[(2R,4R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R,4R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 170194901 |
| Molecular Formula | C16H25N6O5+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[(2R,4R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CC1[C@@H](O)C([n+]2cn(C)c3c(=O)[nH]c(N)nc32)O[C@@H]1C |
| InChI | InChI=1S/C16H24N6O5/c1-8-9(6-10(23)18-4-5-26-3)12(24)15(27-8)22-7-21(2)11-13(22)19-16(17)20-14(11)25/h7-9,12,15,24H,4-6H2,1-3H3,(H3-,17,18,19,20,23,25)/p+1/t8-,9?,12-,15?/m1/s1 |
| InChIKey | DLVCJKZXNBINPB-AAXOJKTDSA-O |
| XLogP | -1.82 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|