C19H31N6O4+ — CID 170298881
2-[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-hexylacetamide (PubChem CID 170298881) has the molecular formula C19H31N6O4+ and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-hexylacetamide.
| Compound Name | 2-[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-hexylacetamide |
|---|---|
| PubChem CID | 170298881 |
| Molecular Formula | C19H31N6O4+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-4-hydroxy-2-methyloxolan-3-yl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)C[C@H]1[C@@H](O)[C@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)O[C@@H]1C |
| InChI | InChI=1S/C19H30N6O4/c1-4-5-6-7-8-21-13(26)9-12-11(2)29-18(15(12)27)25-10-24(3)14-16(25)22-19(20)23-17(14)28/h10-12,15,18,27H,4-9H2,1-3H3,(H3-,20,21,22,23,26,28)/p+1/t11-,12-,15-,18-/m1/s1 |
| InChIKey | SMRBWVMOUJBARY-CBBSBYJHSA-O |
| XLogP | 0.11 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|