C14H20F2N5O4+ — CID 170294684
2-amino-9-[(2R,3R,4S,5R)-4-[2-(difluoromethoxy)ethyl]-3-hydroxy-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 170294684) has the molecular formula C14H20F2N5O4+ and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-4-[2-(difluoromethoxy)ethyl]-3-hydroxy-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-4-[2-(difluoromethoxy)ethyl]-3-hydroxy-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 170294684 |
| Molecular Formula | C14H20F2N5O4+ |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-4-[2-(difluoromethoxy)ethyl]-3-hydroxy-5-methyloxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | C[C@H]1O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1CCOC(F)F |
| InChI | InChI=1S/C14H19F2N5O4/c1-6-7(3-4-24-13(15)16)9(22)12(25-6)21-5-20(2)8-10(21)18-14(17)19-11(8)23/h5-7,9,12-13,22H,3-4H2,1-2H3,(H2-,17,18,19,23)/p+1/t6-,7-,9-,12-/m1/s1 |
| InChIKey | NGSRGUCADGIHBO-GRIPGOBMSA-O |
| XLogP | -0.34 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|