C16H26N5O4+ — CID 170294799
2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-methyl-4-(2-propoxyethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 170294799) has the molecular formula C16H26N5O4+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-methyl-4-(2-propoxyethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-methyl-4-(2-propoxyethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 170294799 |
| Molecular Formula | C16H26N5O4+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-methyl-4-(2-propoxyethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | CCCOCC[C@H]1[C@@H](O)[C@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)O[C@@H]1C |
| InChI | InChI=1S/C16H25N5O4/c1-4-6-24-7-5-10-9(2)25-15(12(10)22)21-8-20(3)11-13(21)18-16(17)19-14(11)23/h8-10,12,15,22H,4-7H2,1-3H3,(H2-,17,18,19,23)/p+1/t9-,10-,12-,15-/m1/s1 |
| InChIKey | XLEAYPIVUGLARW-NDLNZWKESA-O |
| XLogP | -0.16 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|