C12H17ClN5O3+ — CID 90895984
(2R,3S)-5-[8-chloro-2-(dimethylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 90895984) has the molecular formula C12H17ClN5O3+ and a molecular weight of 314.75 g/mol. Its IUPAC name is (2R,3S)-5-[8-chloro-2-(dimethylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S)-5-[8-chloro-2-(dimethylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 90895984 |
| Molecular Formula | C12H17ClN5O3+ |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R,3S)-5-[8-chloro-2-(dimethylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CN(C)c1nc2nc(Cl)[nH]c2c[n+]1C1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C12H16ClN5O3/c1-17(2)12-16-10-6(14-11(13)15-10)4-18(12)9-3-7(20)8(5-19)21-9/h4,7-9,19-20H,3,5H2,1-2H3/p+1/t7-,8+,9?/m0/s1 |
| InChIKey | XAIHSIKXKMOUDW-ZQTLJVIJSA-O |
| XLogP | -0.39 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|