C11H14ClN4O4+ — CID 91027671
(2R,3S)-5-(8-chloro-2-methoxy-7H-purin-1-ium-1-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 91027671) has the molecular formula C11H14ClN4O4+ and a molecular weight of 301.71 g/mol. Its IUPAC name is (2R,3S)-5-(8-chloro-2-methoxy-7H-purin-1-ium-1-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S)-5-(8-chloro-2-methoxy-7H-purin-1-ium-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 91027671 |
| Molecular Formula | C11H14ClN4O4+ |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R,3S)-5-(8-chloro-2-methoxy-7H-purin-1-ium-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | COc1nc2nc(Cl)[nH]c2c[n+]1C1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H13ClN4O4/c1-19-11-15-9-5(13-10(12)14-9)3-16(11)8-2-6(18)7(4-17)20-8/h3,6-8,17-18H,2,4H2,1H3/p+1/t6-,7+,8?/m0/s1 |
| InChIKey | BAQUKMVHAVAMFB-KJFJCRTCSA-O |
| XLogP | -0.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|