C12H18N2O4 — CID 163695430
3-[(2R,5S)-4-amino-5-(methoxymethyl)oxolan-2-yl]-5-methyl-3H-pyridine-2,6-dione (PubChem CID 163695430) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[(2R,5S)-4-amino-5-(methoxymethyl)oxolan-2-yl]-5-methyl-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2R,5S)-4-amino-5-(methoxymethyl)oxolan-2-yl]-5-methyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 163695430 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[(2R,5S)-4-amino-5-(methoxymethyl)oxolan-2-yl]-5-methyl-3H-pyridine-2,6-dione |
| SMILES | COC[C@H]1O[C@@H](C2C=C(C)C(=O)NC2=O)CC1N |
| InChI | InChI=1S/C12H18N2O4/c1-6-3-7(12(16)14-11(6)15)9-4-8(13)10(18-9)5-17-2/h3,7-10H,4-5,13H2,1-2H3,(H,14,15,16)/t7?,8?,9-,10-/m1/s1 |
| InChIKey | JWOADFRCSGYNGE-YDYPAMBWSA-N |
| XLogP | -0.66 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|