C34H34NO7P — CID 134933270
bis(ethenyl) [(2R,3S,5R)-5-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)-2-(2,2,2-triphenylethyl)oxolan-3-yl] phosphate (PubChem CID 134933270) has the molecular formula C34H34NO7P and a molecular weight of 599.62 g/mol. Its IUPAC name is bis(ethenyl) [(2R,3S,5R)-5-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)-2-(2,2,2-triphenylethyl)oxolan-3-yl] phosphate.
| Compound Name | bis(ethenyl) [(2R,3S,5R)-5-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)-2-(2,2,2-triphenylethyl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 134933270 |
| Molecular Formula | C34H34NO7P |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | bis(ethenyl) [(2R,3S,5R)-5-(5-methyl-2,6-dioxo-3H-pyridin-3-yl)-2-(2,2,2-triphenylethyl)oxolan-3-yl] phosphate |
| SMILES | C=COP(=O)(OC=C)O[C@H]1C[C@H](C2C=C(C)C(=O)NC2=O)O[C@@H]1CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34NO7P/c1-4-39-43(38,40-5-2)42-30-22-29(28-21-24(3)32(36)35-33(28)37)41-31(30)23-34(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h4-21,28-31H,1-2,22-23H2,3H3,(H,35,36,37)/t28?,29-,30+,31-/m1/s1 |
| InChIKey | KBMFOYYVQGCNQF-XJMDHDFLSA-N |
| XLogP | 6.60 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|