C18H26N2O2S — CID 168962156
2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane (PubChem CID 168962156) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane.
| Compound Name | 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane |
|---|---|
| PubChem CID | 168962156 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane |
| SMILES | CC.COCC1O[C@@H](n2ccc3cc(C)ccc3c2=S)C[C@H]1N |
| InChI | InChI=1S/C16H20N2O2S.C2H6/c1-10-3-4-12-11(7-10)5-6-18(16(12)21)15-8-13(17)14(20-15)9-19-2;1-2/h3-7,13-15H,8-9,17H2,1-2H3;1-2H3/t13-,14?,15-;/m1./s1 |
| InChIKey | WZCVDDCGTURJNI-LILTVWHLSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|