About 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane
2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane (PubChem CID 168962156) has the molecular formula C18H26N2O2S
and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane.
Molecular Properties
| Compound Name | 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane |
| PubChem CID | 168962156 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane |
| SMILES | CC.COCC1O[C@@H](n2ccc3cc(C)ccc3c2=S)C[C@H]1N |
| InChI | InChI=1S/C16H20N2O2S.C2H6/c1-10-3-4-12-11(7-10)5-6-18(16(12)21)15-8-13(17)14(20-15)9-19-2;1-2/h3-7,13-15H,8-9,17H2,1-2H3;1-2H3/t13-,14?,15-;/m1./s1 |
| InChIKey | WZCVDDCGTURJNI-LILTVWHLSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane?
The IUPAC name of 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane (CID 168962156) is 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane.
What is the SMILES notation for 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane?
The canonical SMILES for 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane is CC.COCC1O[C@@H](n2ccc3cc(C)ccc3c2=S)C[C@H]1N.
What is the InChIKey of 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane?
The InChIKey is WZCVDDCGTURJNI-LILTVWHLSA-N. The full InChI is InChI=1S/C16H20N2O2S.C2H6/c1-10-3-4-12-11(7-10)5-6-18(16(12)21)15-8-13(17)14(20-15)9-19-2;1-2/h3-7,13-15H,8-9,17H2,1-2H3;1-2H3/t13-,14?,15-;/m1./s1.
What are the key properties of 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane?
2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane has a molecular weight of 334.49 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4R)-4-amino-5-(methoxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione;ethane is sourced from PubChem (CID 168962156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).