C13H15NO3S2 — CID 146330294
6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylthieno[2,3-c]pyridine-7-thione (PubChem CID 146330294) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylthieno[2,3-c]pyridine-7-thione.
| Compound Name | 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylthieno[2,3-c]pyridine-7-thione |
|---|---|
| PubChem CID | 146330294 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylthieno[2,3-c]pyridine-7-thione |
| SMILES | Cc1cc2ccn([C@H]3CC(O)[C@@H](CO)O3)c(=S)c2s1 |
| InChI | InChI=1S/C13H15NO3S2/c1-7-4-8-2-3-14(13(18)12(8)19-7)11-5-9(16)10(6-15)17-11/h2-4,9-11,15-16H,5-6H2,1H3/t9?,10-,11-/m1/s1 |
| InChIKey | QCEFVUSYFUJCOI-FHZGLPGMSA-N |
| XLogP | 2.38 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|