C11H12N2O3S2 — CID 156737100
5-[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione (PubChem CID 156737100) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione.
| Compound Name | 5-[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione |
|---|---|
| PubChem CID | 156737100 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5-[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione |
| SMILES | OCC1OC(n2ccc3ncsc3c2=S)C[C@H]1O |
| InChI | InChI=1S/C11H12N2O3S2/c14-4-8-7(15)3-9(16-8)13-2-1-6-10(11(13)17)18-5-12-6/h1-2,5,7-9,14-15H,3-4H2/t7-,8?,9?/m1/s1 |
| InChIKey | KDKVRKJGKNISAH-AFPNSQJFSA-N |
| XLogP | 1.47 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|