C11H12N2O4S2 — CID 156737114
5-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione (PubChem CID 156737114) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione.
| Compound Name | 5-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione |
|---|---|
| PubChem CID | 156737114 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[5,4-c]pyridine-4-thione |
| SMILES | OC[C@H]1O[C@@H](n2ccc3ncsc3c2=S)C(O)C1O |
| InChI | InChI=1S/C11H12N2O4S2/c14-3-6-7(15)8(16)10(17-6)13-2-1-5-9(11(13)18)19-4-12-5/h1-2,4,6-8,10,14-16H,3H2/t6-,7?,8?,10-/m1/s1 |
| InChIKey | SOVKREWNFYXEME-NPDIDSPYSA-N |
| XLogP | 0.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|