C20H20N2O3S2 — CID 157339339
[(2R,3S,5R)-5-ethyl-4-methyl-2-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-3-yl] benzoate (PubChem CID 157339339) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 157339339 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](n2ccc3ncsc3c2=S)[C@@H](OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C20H20N2O3S2/c1-3-15-12(2)16(25-20(23)13-7-5-4-6-8-13)18(24-15)22-10-9-14-17(19(22)26)27-11-21-14/h4-12,15-16,18H,3H2,1-2H3/t12?,15-,16+,18-/m1/s1 |
| InChIKey | FCJICOGNENMEIF-NZHQHIMKSA-N |
| XLogP | 5.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|