C22H23N5O3 — CID 159390723
[(3R,4R,5R)-2-(4-amino-5-isocyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate (PubChem CID 159390723) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is [(3R,4R,5R)-2-(4-amino-5-isocyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(3R,4R,5R)-2-(4-amino-5-isocyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 159390723 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(3R,4R,5R)-2-(4-amino-5-isocyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate |
| SMILES | [C-]#[N+]c1cn(C2O[C@H](CC)[C@@H](C)[C@H]2OC(=O)c2ccccc2)c2nc(C)nc(N)c12 |
| InChI | InChI=1S/C22H23N5O3/c1-5-16-12(2)18(30-22(28)14-9-7-6-8-10-14)21(29-16)27-11-15(24-4)17-19(23)25-13(3)26-20(17)27/h6-12,16,18,21H,5H2,1-3H3,(H2,23,25,26)/t12-,16-,18-,21?/m1/s1 |
| InChIKey | RAHIXXAKXLGJBB-PJJGLARJSA-N |
| XLogP | 4.04 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|