C25H22ClN5O5 — CID 58049086
[(2R,3S,5R)-5-(6-amino-2-chloropurin-7-yl)-4-benzoyloxy-2-ethyloxolan-3-yl] benzoate (PubChem CID 58049086) has the molecular formula C25H22ClN5O5 and a molecular weight of 507.93 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-chloropurin-7-yl)-4-benzoyloxy-2-ethyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-chloropurin-7-yl)-4-benzoyloxy-2-ethyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58049086 |
| Molecular Formula | C25H22ClN5O5 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-chloropurin-7-yl)-4-benzoyloxy-2-ethyloxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3nc(Cl)nc(N)c32)C(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22ClN5O5/c1-2-16-18(35-23(32)14-9-5-3-6-10-14)19(36-24(33)15-11-7-4-8-12-15)22(34-16)31-13-28-21-17(31)20(27)29-25(26)30-21/h3-13,16,18-19,22H,2H2,1H3,(H2,27,29,30)/t16-,18+,19?,22-/m1/s1 |
| InChIKey | YYBVSKOZMAEAKE-GNIVAGDMSA-N |
| XLogP | 3.82 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |