C31H24ClN5O7 — CID 88559361
[(2R,5S)-5-(6-amino-2-chloropurin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 88559361) has the molecular formula C31H24ClN5O7 and a molecular weight of 614.01 g/mol. Its IUPAC name is [(2R,5S)-5-(6-amino-2-chloropurin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5S)-5-(6-amino-2-chloropurin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 88559361 |
| Molecular Formula | C31H24ClN5O7 |
| Molecular Weight | 614.01 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | [(2R,5S)-5-(6-amino-2-chloropurin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | Nc1nc(Cl)nc2ncn([C@H]3O[C@H](COC(=O)c4ccccc4)C(OC(=O)c4ccccc4)C3OC(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C31H24ClN5O7/c32-31-35-25(33)22-26(36-31)34-17-37(22)27-24(44-30(40)20-14-8-3-9-15-20)23(43-29(39)19-12-6-2-7-13-19)21(42-27)16-41-28(38)18-10-4-1-5-11-18/h1-15,17,21,23-24,27H,16H2,(H2,33,35,36)/t21-,23?,24?,27+/m1/s1 |
| InChIKey | PDRZGHMHFODIPE-QOBJACCBSA-N |
| XLogP | 4.27 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|