C18H20N2O4S — CID 118476684
[(2R,3S,5R)-5-ethyl-4-methyl-2-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 118476684) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 118476684 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=S)[C@@H](OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C18H20N2O4S/c1-3-13-11(2)15(24-17(22)12-7-5-4-6-8-12)16(23-13)20-10-9-14(21)19-18(20)25/h4-11,13,15-16H,3H2,1-2H3,(H,19,21,25)/t11?,13-,15+,16-/m1/s1 |
| InChIKey | CIKCIUNFYWHCBB-AXUXKHHZSA-N |
| XLogP | 3.07 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|