C38H43N5O8 — CID 158006301
[(2S,3R,4R,5R)-2-acetyloxy-5-ethyl-4-methyloxolan-3-yl] benzoate;[(2R,3R,4R,5R)-2-(4-azido-3-methylpyrrolo[2,3-b]pyridin-1-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate (PubChem CID 158006301) has the molecular formula C38H43N5O8 and a molecular weight of 697.79 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-acetyloxy-5-ethyl-4-methyloxolan-3-yl] benzoate;[(2R,3R,4R,5R)-2-(4-azido-3-methylpyrrolo[2,3-b]pyridin-1-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R)-2-acetyloxy-5-ethyl-4-methyloxolan-3-yl] benzoate;[(2R,3R,4R,5R)-2-(4-azido-3-methylpyrrolo[2,3-b]pyridin-1-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 158006301 |
| Molecular Formula | C38H43N5O8 |
| Molecular Weight | 697.79 g/mol |
| Exact Mass | 697.31 |
| IUPAC Name | [(2S,3R,4R,5R)-2-acetyloxy-5-ethyl-4-methyloxolan-3-yl] benzoate;[(2R,3R,4R,5R)-2-(4-azido-3-methylpyrrolo[2,3-b]pyridin-1-yl)-5-ethyl-4-methyloxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(=O)c2ccccc2)[C@@H]1C.CC[C@H]1O[C@@H](n2cc(C)c3c(N=[N+]=[N-])ccnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C22H23N5O3.C16H20O5/c1-4-17-14(3)19(30-22(28)15-8-6-5-7-9-15)21(29-17)27-12-13(2)18-16(25-26-23)10-11-24-20(18)27;1-4-13-10(2)14(16(20-13)19-11(3)17)21-15(18)12-8-6-5-7-9-12/h5-12,14,17,19,21H,4H2,1-3H3;5-10,13-14,16H,4H2,1-3H3/t14-,17-,19-,21-;10-,13-,14-,16-/m11/s1 |
| InChIKey | FEIHRQFFCBHDPX-GVNVMKACSA-N |
| XLogP | 8.00 |
| TPSA | 163.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|