C15H17NO3S — CID 164880819
2-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione (PubChem CID 164880819) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione.
| Compound Name | 2-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione |
|---|---|
| PubChem CID | 164880819 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylisoquinoline-1-thione |
| SMILES | Cc1ccc2c(=S)n([C@H]3CC(O)C(CO)O3)ccc2c1 |
| InChI | InChI=1S/C15H17NO3S/c1-9-2-3-11-10(6-9)4-5-16(15(11)20)14-7-12(18)13(8-17)19-14/h2-6,12-14,17-18H,7-8H2,1H3/t12?,13?,14-/m1/s1 |
| InChIKey | ISOKBQJGUJTDAE-JXQTWKCFSA-N |
| XLogP | 2.32 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|