C22H42N2O4Si2 — CID 140534274
3-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-imino-3H-pyridin-2-one (PubChem CID 140534274) has the molecular formula C22H42N2O4Si2 and a molecular weight of 454.76 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-imino-3H-pyridin-2-one.
| Compound Name | 3-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-imino-3H-pyridin-2-one |
|---|---|
| PubChem CID | 140534274 |
| Molecular Formula | C22H42N2O4Si2 |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-6-imino-3H-pyridin-2-one |
| SMILES | [H]/N=C1\C=CC([C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)C(=O)N1 |
| InChI | InChI=1S/C22H42N2O4Si2/c1-21(2,3)29(7,8)26-14-18-17(28-30(9,10)22(4,5)6)13-16(27-18)15-11-12-19(23)24-20(15)25/h11-12,15-18H,13-14H2,1-10H3,(H2,23,24,25)/t15?,16-,17-,18-/m1/s1 |
| InChIKey | IPGVOCLTKQDBHL-QSLYMNIHSA-N |
| XLogP | 4.84 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|