C10H16O2 — CID 163576998
(4S,5S,6R,9R)-9-methyldispiro[2.1.25.23]nonane-4,6-diol (PubChem CID 163576998) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (4S,5S,6R,9R)-9-methyldispiro[2.1.25.23]nonane-4,6-diol.
| Compound Name | (4S,5S,6R,9R)-9-methyldispiro[2.1.25.23]nonane-4,6-diol |
|---|---|
| PubChem CID | 163576998 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (4S,5S,6R,9R)-9-methyldispiro[2.1.25.23]nonane-4,6-diol |
| SMILES | C[C@@H]1C[C@@]2(C[C@H]2O)[C@@H](O)C12CC2 |
| InChI | InChI=1S/C10H16O2/c1-6-4-10(5-7(10)11)8(12)9(6)2-3-9/h6-8,11-12H,2-5H2,1H3/t6-,7-,8+,10+/m1/s1 |
| InChIKey | GEIWMGSGXXNYHV-ODXREFDESA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |