C14H10N4O2S2 — CID 163581917
2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile (PubChem CID 163581917) has the molecular formula C14H10N4O2S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 163581917 |
| Molecular Formula | C14H10N4O2S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(CSc2nc(-c3cccs3)c(C#N)c(=O)[nH]2)on1 |
| InChI | InChI=1S/C14H10N4O2S2/c1-8-5-9(20-18-8)7-22-14-16-12(11-3-2-4-21-11)10(6-15)13(19)17-14/h2-5H,7H2,1H3,(H,16,17,19) |
| InChIKey | FAPPTGYLTADANL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|