C9H5N3OS — CID 175816359
6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile (PubChem CID 175816359) has the molecular formula C9H5N3OS and a molecular weight of 203.23 g/mol. Its IUPAC name is 6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 175816359 |
| Molecular Formula | C9H5N3OS |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 6-oxo-4-thiophen-2-yl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)nc[nH]c1=O |
| InChI | InChI=1S/C9H5N3OS/c10-4-6-8(7-2-1-3-14-7)11-5-12-9(6)13/h1-3,5H,(H,11,12,13) |
| InChIKey | UTPREZSUMRSBJH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |