C9H11N3S — CID 39101600
2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethanamine (PubChem CID 39101600) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethanamine.
| Compound Name | 2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 39101600 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethanamine |
| SMILES | NCCc1[nH]cnc1-c1cccs1 |
| InChI | InChI=1S/C9H11N3S/c10-4-3-7-9(12-6-11-7)8-2-1-5-13-8/h1-2,5-6H,3-4,10H2,(H,11,12) |
| InChIKey | IETGAJJKNNRANH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |