C10H6N2O2S — CID 142578268
5-thiophen-2-yl-3H-furo[2,3-d]pyrimidin-4-one (PubChem CID 142578268) has the molecular formula C10H6N2O2S and a molecular weight of 218.24 g/mol. Its IUPAC name is 5-thiophen-2-yl-3H-furo[2,3-d]pyrimidin-4-one.
| Compound Name | 5-thiophen-2-yl-3H-furo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142578268 |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 5-thiophen-2-yl-3H-furo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2occ(-c3cccs3)c12 |
| InChI | InChI=1S/C10H6N2O2S/c13-9-8-6(7-2-1-3-15-7)4-14-10(8)12-5-11-9/h1-5H,(H,11,12,13) |
| InChIKey | HAHUKFGTQZRUTN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |