C10H13F3N2 — CID 163582066
3-[(2S)-2-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-5-yl]butanenitrile (PubChem CID 163582066) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-[(2S)-2-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-5-yl]butanenitrile.
| Compound Name | 3-[(2S)-2-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-5-yl]butanenitrile |
|---|---|
| PubChem CID | 163582066 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-[(2S)-2-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-5-yl]butanenitrile |
| SMILES | CC(CC#N)C1=CC[C@@H](C(F)(F)F)NC1 |
| InChI | InChI=1S/C10H13F3N2/c1-7(4-5-14)8-2-3-9(15-6-8)10(11,12)13/h2,7,9,15H,3-4,6H2,1H3/t7?,9-/m0/s1 |
| InChIKey | GIJQUOHUWBONPZ-NETXQHHPSA-N |
| XLogP | 2.39 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|