C12H17F3N2 — CID 103277237
2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetonitrile (PubChem CID 103277237) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetonitrile.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetonitrile |
|---|---|
| PubChem CID | 103277237 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetonitrile |
| SMILES | CC1=CC(C)CC(C(C#N)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H17F3N2/c1-8-3-9(2)5-10(4-8)11(6-16)17-7-12(13,14)15/h3,8,10-11,17H,4-5,7H2,1-2H3 |
| InChIKey | NEVABLSCKJKHJS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|