About 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole
1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole (PubChem CID 163582276) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole |
| PubChem CID | 163582276 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole |
| SMILES | CCC1N=NNN1CC1CCCCC1 |
| InChI | InChI=1S/C10H20N4/c1-2-10-11-12-13-14(10)8-9-6-4-3-5-7-9/h9-10H,2-8H2,1H3,(H,11,13) |
| InChIKey | GIOCGOZBJTUVST-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole?
The IUPAC name of 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole (CID 163582276) is 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole.
What is the SMILES notation for 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole?
The canonical SMILES for 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole is CCC1N=NNN1CC1CCCCC1.
What is the InChIKey of 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole?
The InChIKey is GIOCGOZBJTUVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-2-10-11-12-13-14(10)8-9-6-4-3-5-7-9/h9-10H,2-8H2,1H3,(H,11,13).
What are the key properties of 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole?
1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole has a molecular weight of 196.30 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-5-ethyl-2,5-dihydrotetrazole is sourced from PubChem (CID 163582276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).