C11H15NOS — CID 163583514
(Z)-1-(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)prop-1-en-1-ol (PubChem CID 163583514) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is (Z)-1-(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)prop-1-en-1-ol.
| Compound Name | (Z)-1-(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 163583514 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (Z)-1-(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)prop-1-en-1-ol |
| SMILES | C/C=C(\O)c1cc2c(s1)CCN(C)C2 |
| InChI | InChI=1S/C11H15NOS/c1-3-9(13)11-6-8-7-12(2)5-4-10(8)14-11/h3,6,13H,4-5,7H2,1-2H3/b9-3- |
| InChIKey | GJOIQYDSMQFXCG-OQFOIZHKSA-N |
| XLogP | 2.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|