C25H34BN5O4S — CID 163584846
2-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-[6-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)-1H-indazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 163584846) has the molecular formula C25H34BN5O4S and a molecular weight of 511.46 g/mol. Its IUPAC name is 2-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-[6-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)-1H-indazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-[6-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)-1H-indazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163584846 |
| Molecular Formula | C25H34BN5O4S |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-N-[6-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)-1H-indazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2nc(C(=O)Nc3cc(B4OC(C)(C)CC(C)(C)O4)cc4[nH]ncc34)cs2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H34BN5O4S/c1-15-10-31(11-16(2)33-15)12-22-28-21(13-36-22)23(32)29-19-7-17(8-20-18(19)9-27-30-20)26-34-24(3,4)14-25(5,6)35-26/h7-9,13,15-16H,10-12,14H2,1-6H3,(H,27,30)(H,29,32)/t15-,16+ |
| InChIKey | GKPQLOQAKJMMRM-IYBDPMFKSA-N |
| XLogP | 3.57 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|