C36H31N — CID 163586072
2-[(1Z)-buta-1,3-dienyl]-4-(7-tert-butyl-3-phenylpyren-1-yl)aniline (PubChem CID 163586072) has the molecular formula C36H31N and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-4-(7-tert-butyl-3-phenylpyren-1-yl)aniline.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-4-(7-tert-butyl-3-phenylpyren-1-yl)aniline |
|---|---|
| PubChem CID | 163586072 |
| Molecular Formula | C36H31N |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-4-(7-tert-butyl-3-phenylpyren-1-yl)aniline |
| SMILES | C=C/C=C\c1cc(-c2cc(-c3ccccc3)c3ccc4cc(C(C)(C)C)cc5ccc2c3c45)ccc1N |
| InChI | InChI=1S/C36H31N/c1-5-6-10-25-19-24(15-18-33(25)37)32-22-31(23-11-8-7-9-12-23)29-16-13-26-20-28(36(2,3)4)21-27-14-17-30(32)35(29)34(26)27/h5-22H,1,37H2,2-4H3/b10-6- |
| InChIKey | GLOOFZLJPALDDY-POHAHGRESA-N |
| XLogP | 10.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|