C45H34N2 — CID 58028975
2-[4-[7-tert-butyl-3-(4-phenylphenyl)pyren-1-yl]phenyl]-1H-benzimidazole (PubChem CID 58028975) has the molecular formula C45H34N2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 2-[4-[7-tert-butyl-3-(4-phenylphenyl)pyren-1-yl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[4-[7-tert-butyl-3-(4-phenylphenyl)pyren-1-yl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 58028975 |
| Molecular Formula | C45H34N2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-[4-[7-tert-butyl-3-(4-phenylphenyl)pyren-1-yl]phenyl]-1H-benzimidazole |
| SMILES | CC(C)(C)c1cc2ccc3c(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc(-c5nc6ccccc6[nH]5)cc4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C45H34N2/c1-45(2,3)35-25-33-21-23-36-38(30-15-13-29(14-16-30)28-9-5-4-6-10-28)27-39(37-24-22-34(26-35)42(33)43(36)37)31-17-19-32(20-18-31)44-46-40-11-7-8-12-41(40)47-44/h4-27H,1-3H3,(H,46,47) |
| InChIKey | LEUQKTHDFLGQLT-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|