C19H27NO3 — CID 163586476
(2R,11bS)-2-hydroxy-10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9-carbaldehyde (PubChem CID 163586476) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R,11bS)-2-hydroxy-10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9-carbaldehyde.
| Compound Name | (2R,11bS)-2-hydroxy-10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9-carbaldehyde |
|---|---|
| PubChem CID | 163586476 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2R,11bS)-2-hydroxy-10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9-carbaldehyde |
| SMILES | COc1cc2c(cc1C=O)CCN1CC(CC(C)C)[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C19H27NO3/c1-12(2)6-14-10-20-5-4-13-7-15(11-21)19(23-3)8-16(13)17(20)9-18(14)22/h7-8,11-12,14,17-18,22H,4-6,9-10H2,1-3H3/t14?,17-,18+/m0/s1 |
| InChIKey | GLXRPWZHECAOLO-CXRLMVSZSA-N |
| XLogP | 2.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|