C19H25NO3 — CID 58149789
(2R,3S,11bR)-2-hydroxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9,10-dicarbaldehyde (PubChem CID 58149789) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2R,3S,11bR)-2-hydroxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9,10-dicarbaldehyde.
| Compound Name | (2R,3S,11bR)-2-hydroxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9,10-dicarbaldehyde |
|---|---|
| PubChem CID | 58149789 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2R,3S,11bR)-2-hydroxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine-9,10-dicarbaldehyde |
| SMILES | CC(C)C[C@H]1CN2CCc3cc(C=O)c(C=O)cc3[C@H]2C[C@H]1O |
| InChI | InChI=1S/C19H25NO3/c1-12(2)5-14-9-20-4-3-13-6-15(10-21)16(11-22)7-17(13)18(20)8-19(14)23/h6-7,10-12,14,18-19,23H,3-5,8-9H2,1-2H3/t14-,18+,19+/m0/s1 |
| InChIKey | VFVPIAQEIJCGSN-GDIGMMSISA-N |
| XLogP | 2.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|