C23H25N3O — CID 163587998
4-[2-(14-methyl-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethyl]benzaldehyde (PubChem CID 163587998) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[2-(14-methyl-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethyl]benzaldehyde.
| Compound Name | 4-[2-(14-methyl-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethyl]benzaldehyde |
|---|---|
| PubChem CID | 163587998 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-[2-(14-methyl-6,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethyl]benzaldehyde |
| SMILES | Cc1ccc2c(n1)c1c(n2CCc2ccc(C=O)cc2)CCN2CCCC12 |
| InChI | InChI=1S/C23H25N3O/c1-16-4-9-21-23(24-16)22-19-3-2-12-25(19)13-11-20(22)26(21)14-10-17-5-7-18(15-27)8-6-17/h4-9,15,19H,2-3,10-14H2,1H3 |
| InChIKey | GNCUUWPAOXVUEW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|