C11H12N2O3S2 — CID 163593990
2,5-dimethyl-N-(4-oxo-1H-pyridin-3-yl)thiophene-3-sulfonamide (PubChem CID 163593990) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-oxo-1H-pyridin-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-(4-oxo-1H-pyridin-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 163593990 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2,5-dimethyl-N-(4-oxo-1H-pyridin-3-yl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2c[nH]ccc2=O)c(C)s1 |
| InChI | InChI=1S/C11H12N2O3S2/c1-7-5-11(8(2)17-7)18(15,16)13-9-6-12-4-3-10(9)14/h3-6,13H,1-2H3,(H,12,14) |
| InChIKey | GRWHHVYGXAMMIK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |